What is the molecular formula of sulfosuccinic acid?
The molecular formula of sulfosuccinic acid is C4H6O7S.
What is the molecular weight of sulfosuccinic acid?
The molecular weight of sulfosuccinic acid is 198.15 g/mol.
What is the IUPAC name of sulfosuccinic acid?
The IUPAC name of sulfosuccinic acid is 2-sulfobutanedioic acid.
What is the InChIKey of sulfosuccinic acid?
The InChIKey of sulfosuccinic acid is ULUAUXLGCMPNKK-UHFFFAOYSA-N.
What is the canonical SMILES representation of sulfosuccinic acid?
The canonical SMILES representation of sulfosuccinic acid is C(C(C(=O)O)S(=O)(=O)O)C(=O)O.
What is the CAS number of sulfosuccinic acid?
The CAS number of sulfosuccinic acid is 5138-18-1.
What is the XLogP3-AA value of sulfosuccinic acid?
The XLogP3-AA value of sulfosuccinic acid is -1.8.
How many hydrogen bond donor counts are there in sulfosuccinic acid?
There are 3 hydrogen bond donor counts in sulfosuccinic acid.
How many hydrogen bond acceptor counts are there in sulfosuccinic acid?
There are 7 hydrogen bond acceptor counts in sulfosuccinic acid.
How many rotatable bond counts are there in sulfosuccinic acid?
There are 4 rotatable bond counts in sulfosuccinic acid.