What is the molecular formula of Sulforhodamine B?
The molecular formula of Sulforhodamine B is C27H30N2O7S2.
What is the molecular weight of Sulforhodamine B?
The molecular weight of Sulforhodamine B is 558.7 g/mol.
What is the IUPAC name of Sulforhodamine B?
The IUPAC name of Sulforhodamine B is 2-[3-(diethylamino)-6-diethylazaniumylidenexanthen-9-yl]-5-sulfobenzenesulfonate.
What is the InChI of Sulforhodamine B?
The InChI of Sulforhodamine B is InChI=1S/C27H30N2O7S2/c1-5-28(6-2)18-9-12-21-24(15-18)36-25-16-19(29(7-3)8-4)10-13-22(25)27(21)23-14-11-20(37(30,31)32)17-26(23)38(33,34)35/h9-17H,5-8H2,1-4H3,(H-,30,31,32,33,34,35).
What is the InChIKey of Sulforhodamine B?
The InChIKey of Sulforhodamine B is IOOMXAQUNPWDLL-UHFFFAOYSA-N.
What is the canonical SMILES of Sulforhodamine B?
The canonical SMILES of Sulforhodamine B is CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=C(C=C(C=C4)S(=O)(=O)O)S(=O)(=O)[O-].
What is the CAS number of Sulforhodamine B?
The CAS number of Sulforhodamine B is 2609-88-3.
What is the EC number of Sulforhodamine B?
The EC number of Sulforhodamine B is 220-025-2.
What is the topological polar surface area of Sulforhodamine B?
The topological polar surface area of Sulforhodamine B is 144Ų.
※ Please kindly note that our products are for research use only.