The synonyms for the compound are Diphenyl[4-(phenylthio)phenyl]sulfonium hexafluorophosphate and Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate.
What is the molecular weight of the compound?
The molecular weight is 516.5 g/mol.
What is the parent compound of the compound?
The parent compound is diphenyl[4-(phenylthio)phenyl] sulfonium.
What are the component compounds of the compound?
The component compounds are sulfonium, diphenyl[4-(phenylthio)phenyl]- and hexafluorophosphate.
What is the IUPAC name of the compound?
The IUPAC name is diphenyl-(4-phenylsulfanylphenyl)sulfanium;hexafluorophosphate.
What is the InChI of the compound?
The InChI is InChI=1S/C24H19S2.F6P/c1-4-10-20(11-5-1)25-21-16-18-24(19-17-21)26(22-12-6-2-7-13-22)23-14-8-3-9-15-23;1-7(2,3,4,5)6/h1-19H;/q+1;-1.
What is the InChIKey of the compound?
The InChIKey is MUVYOKJVJZFJTI-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES is C1=CC=C(C=C1)SC2=CC=C(C=C2)[S+](C3=CC=CC=C3)C4=CC=CC=C4.F[P-](F)(F)(F)(F)F.
What is the topological polar surface area of the compound?
The topological polar surface area is 26.3 Ų.
※ Please kindly note that our products are for research use only.