What is the PubChem CID of Sucrose Stearate?
The PubChem CID of Sucrose Stearate is 9898327.
What is the molecular formula of Sucrose Stearate?
The molecular formula of Sucrose Stearate is C30H56O12.
What are the synonyms of Sucrose Stearate?
The synonyms of Sucrose Stearate include Sucrose, 1-stearate, 136152-91-5, and UNII-58RP7JU52K.
What is the molecular weight of Sucrose Stearate?
The molecular weight of Sucrose Stearate is 608.8 g/mol.
What is the IUPAC name of Sucrose Stearate?
The IUPAC name of Sucrose Stearate is [(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxolan-2-yl]methyl octadecanoate.
What is the InChI of Sucrose Stearate?
The InChI of Sucrose Stearate is InChI=1S/C30H56O12/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(33)39-20-30(28(38)25(35)22(19-32)41-30)42-29-27(37)26(36)24(34)21(18-31)40-29/h21-22,24-29,31-32,34-38H,2-20H2,1H3/t21-,22-,24-,25-,26+,27-,28+,29-,30+/m1/s1.
What is the InChIKey of Sucrose Stearate?
The InChIKey of Sucrose Stearate is SZYSLWCAWVWFLT-UTGHZIEOSA-N.
What are the computed properties of Sucrose Stearate?
The computed properties of Sucrose Stearate include molecular weight (608.8 g/mol), XLogP3 (4.7), hydrogen bond donor count (7), hydrogen bond acceptor count (12), rotatable bond count (23), exact mass (608.37717722 g/mol), monoisotopic mass (608.37717722 g/mol), topological polar surface area (196?2), heavy atom count (42), formal charge (0), complexity (726), isotope atom count (0), defined atom stereocenter count (9), and undefined atom stereocenter count (0).
What is the CAS number of Sucrose Stearate?
The CAS number of Sucrose Stearate is 136152-91-5.
What is the EC number of Sucrose Stearate?
The EC number of Sucrose Stearate is 246-705-9.