What is the molecular formula of Styryl 9M?
The molecular formula of Styryl 9M is C27H31ClN2O4S.
What is the synonym for Styryl 9M?
The synonym for Styryl 9M is "Dye content ~98 % 2-{6[-(4-Dimethylaminophenyl)-2,4-neopentenylene]-1,3,5-hexatrienyl}-3-methylbenzthiazolium perchlorate".
What is the molecular weight of Styryl 9M?
The molecular weight of Styryl 9M is 515.1 g/mol.
When was Styryl 9M created?
Styryl 9M was created on December 5, 2007.
When was Styryl 9M last modified?
Styryl 9M was last modified on December 2, 2023.
What is the IUPAC name of Styryl 9M?
The IUPAC name of Styryl 9M is 4-[(E)-2-[(3Z)-5,5-dimethyl-3-[(3-methyl-1,3-benzothiazol-3-ium-2-yl)methylidene]cyclohexen-1-yl]ethenyl]-N,N-dimethylaniline;perchlorate.
What is the InChI of Styryl 9M?
The InChI of Styryl 9M is InChI=1S/C27H31N2S.ClHO4/c1-27(2)18-21(11-10-20-12-14-23(15-13-20)28(3)4)16-22(19-27)17-26-29(5)24-8-6-7-9-25(24)30-26;2-1(3,4)5/h6-17H,18-19H2,1-5H3;(H,2,3,4,5)/q+1;/p-1.
What is the InChIKey of Styryl 9M?
The InChIKey of Styryl 9M is ZVJQLQFMYXZEDW-UHFFFAOYSA-M.
What is the canonical SMILES of Styryl 9M?
The canonical SMILES of Styryl 9M is CC1(CC(=CC(=CC2=[N+](C3=CC=CC=C3S2)C)C1)C=CC4=CC=C(C=C4)N(C)C)C.[O-]Cl(=O)(=O)=O.
What is the rotational bond count of Styryl 9M?
The rotational bond count of Styryl 9M is 4.