What is the molecular formula of Stearyl behenate?
The molecular formula of Stearyl behenate is C40H80O2.
What is the molecular weight of Stearyl behenate?
The molecular weight of Stearyl behenate is 593.1 g/mol.
What is the IUPAC name of Stearyl behenate?
The IUPAC name of Stearyl behenate is octadecyl docosanoate.
What is the InChI of Stearyl behenate?
The InChI of Stearyl behenate is InChI=1S/C40H80O2/c1-3-5-7-9-11-13-15-17-19-21-22-23-24-26-28-30-32-34-36-38-40(41)42-39-37-35-33-31-29-27-25-20-18-16-14-12-10-8-6-4-2/h3-39H2,1-2H3.
What is the InChIKey of Stearyl behenate?
The InChIKey of Stearyl behenate is GAQPWOABOQGPKA-UHFFFAOYSA-N.
What is the canonical SMILES of Stearyl behenate?
The canonical SMILES of Stearyl behenate is CCCCCCCCCCCCCCCCCCCCC(=O)OCCCCCCCCCCCCCCCCCC.
What is the CAS number of Stearyl behenate?
The CAS number of Stearyl behenate is 24271-12-3.
What is the Lipid Maps ID of Stearyl behenate?
The Lipid Maps ID of Stearyl behenate is LMFA07010060.
What is the XLogP3-AA value of Stearyl behenate?
The XLogP3-AA value of Stearyl behenate is 19.5.
What is the heavy atom count of Stearyl behenate?
The heavy atom count of Stearyl behenate is 42.