What is the molecular formula of Stearic acid-N-hydroxysuccinimide ester?
The molecular formula of Stearic acid-N-hydroxysuccinimide ester is C22H39NO4.
What is the molecular weight of Stearic acid-N-hydroxysuccinimide ester?
The molecular weight of Stearic acid-N-hydroxysuccinimide ester is 381.5 g/mol.
What is the IUPAC name of Stearic acid-N-hydroxysuccinimide ester?
The IUPAC name of Stearic acid-N-hydroxysuccinimide ester is (2,5-dioxopyrrolidin-1-yl) octadecanoate.
What is the InChI of Stearic acid-N-hydroxysuccinimide ester?
The InChI of Stearic acid-N-hydroxysuccinimide ester is InChI=1S/C22H39NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22(26)27-23-20(24)18-19-21(23)25/h2-19H2,1H3.
What is the InChIKey of Stearic acid-N-hydroxysuccinimide ester?
The InChIKey of Stearic acid-N-hydroxysuccinimide ester is ZERWDZDNDJBYKA-UHFFFAOYSA-N.
What is the canonical SMILES of Stearic acid-N-hydroxysuccinimide ester?
The canonical SMILES of Stearic acid-N-hydroxysuccinimide ester is CCCCCCCCCCCCCCCCCC(=O)ON1C(=O)CCC1=O.
What is the CAS number of Stearic acid-N-hydroxysuccinimide ester?
The CAS number of Stearic acid-N-hydroxysuccinimide ester is 14464-32-5.
What is the XLogP3-AA value of Stearic acid-N-hydroxysuccinimide ester?
The XLogP3-AA value of Stearic acid-N-hydroxysuccinimide ester is 7.6.
How many hydrogen bond donor count does Stearic acid-N-hydroxysuccinimide ester have?
Stearic acid-N-hydroxysuccinimide ester has 0 hydrogen bond donor count.
How many hydrogen bond acceptor count does Stearic acid-N-hydroxysuccinimide ester have?
Stearic acid-N-hydroxysuccinimide ester has 4 hydrogen bond acceptor count.
※ Please kindly note that our products are for research use only.