What is the molecular formula of Sorbohydroxamic acid?
The molecular formula of Sorbohydroxamic acid is C6H9NO2.
What are the synonyms for Sorbohydroxamic acid?
The synonyms for Sorbohydroxamic acid include:
(2E,4E)-N-hydroxyhexa-2,4-dienamide
Sorbohydroximic acid
N-HYDROXY-2,4-HEXADIENAMIDE
What is the molecular weight of Sorbohydroxamic acid?
The molecular weight of Sorbohydroxamic acid is 127.14 g/mol.
When was Sorbohydroxamic acid created?
Sorbohydroxamic acid was created on September 9, 2005.
When was Sorbohydroxamic acid last modified?
Sorbohydroxamic acid was last modified on October 21, 2023.
What is the IUPAC name of Sorbohydroxamic acid?
The IUPAC name of Sorbohydroxamic acid is (2E,4E)-N-hydroxyhexa-2,4-dienamide.
What is the InChI of Sorbohydroxamic acid?
The InChI of Sorbohydroxamic acid is InChI=1S/C6H9NO2/c1-2-3-4-5-6(8)7-9/h2-5,9H,1H3,(H,7,8)/b3-2+,5-4+.
What is the InChIKey of Sorbohydroxamic acid?
The InChIKey of Sorbohydroxamic acid is AKPBWCUNVIPWOM-MQQKCMAXSA-N.
What is the canonical SMILES of Sorbohydroxamic acid?
The canonical SMILES of Sorbohydroxamic acid is CC=CC=CC(=O)NO.
What is the CAS number of Sorbohydroxamic acid?
The CAS number of Sorbohydroxamic acid is 4076-62-4.