What is the molecular formula of Sorbitan isooctadecanoate?
The molecular formula of Sorbitan isooctadecanoate is C23H48O8.
What are the synonyms of Sorbitan isooctadecanoate?
The synonyms of Sorbitan isooctadecanoate are 16-methylheptadecanoic acid and (2S,3R,4S)-pentane-1,1,2,3,4,5-hexol.
What is the molecular weight of Sorbitan isooctadecanoate?
The molecular weight of Sorbitan isooctadecanoate is 452.6 g/mol.
What is the IUPAC name of Sorbitan isooctadecanoate?
The IUPAC name of Sorbitan isooctadecanoate is 16-methylheptadecanoic acid and (2S,3R,4S)-pentane-1,1,2,3,4,5-hexol.
What is the InChI of Sorbitan isooctadecanoate?
The InChI of Sorbitan isooctadecanoate is InChI=1S/C18H36O2.C5H12O6/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20;6-1-2(7)3(8)4(9)5(10)11/h17H,3-16H2,1-2H3,(H,19,20);2-11H,1H2/t;2-,3+,4-/m.0/s1.
What is the InChIKey of Sorbitan isooctadecanoate?
The InChIKey of Sorbitan isooctadecanoate is DAPHOROYFQLVHF-DAPNYWPISA-N.
What are the other identifiers of Sorbitan isooctadecanoate?
The other identifiers of Sorbitan isooctadecanoate are CAS: 71902-01-7 and European Community (EC) Number: 276-171-2.
What is the hydrogen bond donor count of Sorbitan isooctadecanoate?
The hydrogen bond donor count of Sorbitan isooctadecanoate is 7.
What is the hydrogen bond acceptor count of Sorbitan isooctadecanoate?
The hydrogen bond acceptor count of Sorbitan isooctadecanoate is 8.
What is the physical description of Sorbitan isooctadecanoate?
Sorbitan isooctadecanoate is a liquid in terms of its physical description.
※ Please kindly note that our products are for research use only.