What is the molecular formula of Solvent Yellow 93?
The molecular formula of Solvent Yellow 93 is C21H18N4O2.
What is the molecular weight of Solvent Yellow 93?
The molecular weight of Solvent Yellow 93 is 358.4 g/mol.
What is the IUPAC name of Solvent Yellow 93?
The IUPAC name of Solvent Yellow 93 is (4E)-5-methyl-4-[(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methylidene]-2-phenylpyrazol-3-one.
What is the InChI of Solvent Yellow 93?
The InChI of Solvent Yellow 93 is InChI=1S/C21H18N4O2/c1-14-18(20(26)24(22-14)16-9-5-3-6-10-16)13-19-15(2)23-25(21(19)27)17-11-7-4-8-12-17/h3-13,18H,1-2H3/b19-13+.
What is the InChIKey of Solvent Yellow 93?
The InChIKey of Solvent Yellow 93 is QPAPQRFSPBUJAU-CPNJWEJPSA-N.
What is the canonical SMILES of Solvent Yellow 93?
The canonical SMILES of Solvent Yellow 93 is CC1=NN(C(=O)C1C=C2C(=NN(C2=O)C3=CC=CC=C3)C)C4=CC=CC=C4.
What is the CAS number of Solvent Yellow 93?
The CAS number of Solvent Yellow 93 is 4702-90-3.
What is the XLogP3-AA value of Solvent Yellow 93?
The XLogP3-AA value of Solvent Yellow 93 is 2.8.
How many hydrogen bond acceptors does Solvent Yellow 93 have?
Solvent Yellow 93 has 4 hydrogen bond acceptors.
How many rotatable bonds does Solvent Yellow 93 have?
Solvent Yellow 93 has 3 rotatable bonds.
What is the InChI key of Solvent Yellow 93?
The InChI key of Solvent Yellow 93 is QPAPQRFSPBUJAU-CPNJWEJPSA-N.
How many hydrogen bond donor counts does Solvent Yellow 93 have?
Solvent Yellow 93 has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Solvent Yellow 93 have?
Solvent Yellow 93 has 4 hydrogen bond acceptor counts.
How many rotatable bond counts does Solvent Yellow 93 have?
Solvent Yellow 93 has 3 rotatable bond counts.
Download
