What is the molecular formula of Solvent Violet 31?
The molecular formula of Solvent Violet 31 is C14H8Cl2N2O2.
What is the molecular weight of Solvent Violet 31?
The molecular weight of Solvent Violet 31 is 307.1 g/mol.
What is the IUPAC name of Solvent Violet 31?
The IUPAC name of Solvent Violet 31 is 1,4-diamino-2,3-dichloroanthracene-9,10-dione.
What is the InChI of Solvent Violet 31?
The InChI of Solvent Violet 31 is InChI=1S/C14H8Cl2N2O2/c15-9-10(16)12(18)8-7(11(9)17)13(19)5-3-1-2-4-6(5)14(8)20/h1-4H,17-18H2.
What is the InChIKey of Solvent Violet 31?
The InChIKey of Solvent Violet 31 is KZYAYVSWIPZDKL-UHFFFAOYSA-N.
What is the Canonical SMILES of Solvent Violet 31?
The Canonical SMILES of Solvent Violet 31 is C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C(=C3N)Cl)Cl)N.
What is the CAS number of Solvent Violet 31?
The CAS number of Solvent Violet 31 is 81-42-5.
What is the hydrogen bond donor count of Solvent Violet 31?
The hydrogen bond donor count of Solvent Violet 31 is 2.
What is the hydrogen bond acceptor count of Solvent Violet 31?
The hydrogen bond acceptor count of Solvent Violet 31 is 4.
What is the topological polar surface area of Solvent Violet 31?
The topological polar surface area of Solvent Violet 31 is 86.2 ?2.