What is the IUPAC name of SOLVENT RED 135?
The IUPAC name of SOLVENT RED 135 is 5,6,7,8-tetrachloro-2,11-diazapentacyclo[10.7.1.0 2,10 .0 4,9 .0 16,20 ]icosa-1(19),4(9),5,7,10,12,14,16(20),17-nonaen-3-one.
What is the molecular formula of SOLVENT RED 135?
The molecular formula of SOLVENT RED 135 is C18H6Cl4N2O.
What is the molecular weight of SOLVENT RED 135?
The molecular weight of SOLVENT RED 135 is 408.1 g/mol.
What is the InChI of SOLVENT RED 135?
The InChI of SOLVENT RED 135 is InChI=1S/C18H6Cl4N2O/c19-13-11-12(14(20)16(22)15(13)21)18(25)24-9-6-2-4-7-3-1-5-8(10(7)9)23-17(11)24/h1-6H.
What is the InChIKey of SOLVENT RED 135?
The InChIKey of SOLVENT RED 135 is UBZVRROHBDDCQY-UHFFFAOYSA-N.
What is the CAS number of SOLVENT RED 135?
The CAS number of SOLVENT RED 135 is 20749-68-2.
What is the XLogP3-AA value of SOLVENT RED 135?
The XLogP3-AA value of SOLVENT RED 135 is 5.9.
How many hydrogen bond donor counts are there in SOLVENT RED 135?
There are 0 hydrogen bond donor counts in SOLVENT RED 135.
How many hydrogen bond acceptor counts are there in SOLVENT RED 135?
There are 2 hydrogen bond acceptor counts in SOLVENT RED 135.
How many rotatable bond counts are there in SOLVENT RED 135?
There are 0 rotatable bond counts in SOLVENT RED 135.