What is the molecular formula of Solvent Green 5?
The molecular formula of Solvent Green 5 is C30H28O4.
What is the molecular weight of Solvent Green 5?
The molecular weight of Solvent Green 5 is 452.5 g/mol.
What is the IUPAC name of Solvent Green 5?
The IUPAC name of Solvent Green 5 is bis(2-methylpropyl) perylene-3,9-dicarboxylate.
What is the InChI of Solvent Green 5?
The InChI of Solvent Green 5 is InChI=1S/C30H28O4/c1-17(2)15-33-29(31)25-13-11-23-20-8-6-10-22-26(30(32)34-16-18(3)4)14-12-24(28(20)22)19-7-5-9-21(25)27(19)23/h5-14,17-18H,15-16H2,1-4H3.
What is the InChIKey of Solvent Green 5?
The InChIKey of Solvent Green 5 is YLNJGHNUXCVDIX-UHFFFAOYSA-N.
What is the canonical SMILES of Solvent Green 5?
The canonical SMILES of Solvent Green 5 is CC(C)COC(=O)C1=CC=C2C3=C4C(=CC=C3)C(=CC=C4C5=C2C1=CC=C5)C(=O)OCC(C).
What is the CAS number of Solvent Green 5?
The CAS number of Solvent Green 5 is 2744-50-5.
What is the XLogP3-AA value of Solvent Green 5?
The XLogP3-AA value of Solvent Green 5 is 8.1.
How many hydrogen bond donor counts does Solvent Green 5 have?
Solvent Green 5 has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Solvent Green 5 have?
Solvent Green 5 has 4 hydrogen bond acceptor counts.