What is the molecular formula of Solvent Blue 35?
The molecular formula of Solvent Blue 35 is C22H26N2O2.
What is the molecular weight of Solvent Blue 35?
The molecular weight of Solvent Blue 35 is 350.5 g/mol.
What is the IUPAC name of Solvent Blue 35?
The IUPAC name of Solvent Blue 35 is 1,4-bis(butylamino)anthracene-9,10-dione.
What is the Canonical SMILES of Solvent Blue 35?
The Canonical SMILES of Solvent Blue 35 is CCCCNC1=C2C(=C(C=C1)NCCCC)C(=O)C3=CC=CC=C3C2=O.
What is the InChIKey of Solvent Blue 35?
The InChIKey of Solvent Blue 35 is OCQDPIXQTSYZJL-UHFFFAOYSA-N.
What is the CAS number of Solvent Blue 35?
The CAS number of Solvent Blue 35 is 17354-14-2.
What is the XLogP3-AA value of Solvent Blue 35?
The XLogP3-AA value of Solvent Blue 35 is 6.4.
How many hydrogen bond donor counts are there in Solvent Blue 35?
There are 2 hydrogen bond donor counts in Solvent Blue 35.
What is the topological polar surface area of Solvent Blue 35?
The topological polar surface area of Solvent Blue 35 is 58.2 Å2.
How many rotatable bond counts are there in Solvent Blue 35?
There are 8 rotatable bond counts in Solvent Blue 35.