What is the molecular formula of Sodium gentisate?
The molecular formula of Sodium gentisate is C7H5NaO4.
What is the molecular weight of Sodium gentisate?
The molecular weight of Sodium gentisate is 176.10 g/mol.
What is the IUPAC Name of Sodium gentisate?
The IUPAC Name of Sodium gentisate is sodium;2,5-dihydroxybenzoate.
What is the InChIKey of Sodium gentisate?
The InChIKey of Sodium gentisate is MOIJZWWOFOQFMH-UHFFFAOYSA-M.
What is the Canonical SMILES of Sodium gentisate?
The Canonical SMILES of Sodium gentisate is C1=CC(=C(C=C1O)C(=O)[O-])O.[Na+].
What is the CAS number of Sodium gentisate?
The CAS number of Sodium gentisate is 4955-90-2.
How many hydrogen bond donor count does Sodium gentisate have?
Sodium gentisate has 2 hydrogen bond donor counts.
What is the exact mass of Sodium gentisate?
The exact mass of Sodium gentisate is 176.00855292 g/mol.
How many hydrogen bond acceptor count does Sodium gentisate have?
Sodium gentisate has 4 hydrogen bond acceptor counts.
Does Sodium gentisate have any defined atom or bond stereocenters?
No, Sodium gentisate does not have any defined atom or bond stereocenters.