What is the molecular formula of Serinol?
The molecular formula of Serinol is C3H9NO2.
What is the molecular weight of Serinol?
The molecular weight of Serinol is 91.11 g/mol.
What is the IUPAC name of Serinol?
The IUPAC name of Serinol is 2-aminopropane-1,3-diol.
What is the InChI of Serinol?
The InChI of Serinol is InChI=1S/C3H9NO2/c4-3(1-5)2-6/h3,5-6H,1-2,4H2.
What is the InChIKey of Serinol?
The InChIKey of Serinol is KJJPLEZQSCZCKE-UHFFFAOYSA-N.
What is the canonical SMILES of Serinol?
The canonical SMILES of Serinol is C(C(CO)N)O.
What is the CAS number of Serinol?
The CAS number of Serinol is 534-03-2.
What is the UNII of Serinol?
The UNII of Serinol is IC94L30J8M.
What is the XLogP3-AA value of Serinol?
The XLogP3-AA value of Serinol is -2.
How many hydrogen bond donor counts does Serinol have?
Serinol has 3 hydrogen bond donor counts.