What is the molecular formula of Sedecamycin?
The molecular formula of Sedecamycin is C27H35NO8.
What is the molecular weight of Sedecamycin?
The molecular weight of Sedecamycin is 501.6 g/mol.
How was the molecular weight computed?
The molecular weight was computed by PubChem 2.2.
What is the IUPAC Name of Sedecamycin?
The IUPAC Name of Sedecamycin is [(1S,2R,3E,5E,7S,9E,11E,13S,15R,19R)-7-hydroxy-1,4,10,19-tetramethyl-17,18-dioxo-2-(2-oxopropanoylamino)-16-oxabicyclo[13.2.2]nonadeca-3,5,9,11-tetraen-13-yl] acetate.
What is the InChI of Sedecamycin?
The InChI of Sedecamycin is InChI=1S/C27H35NO8/c1-15-7-10-20(31)11-8-16(2)13-23(28-25(33)18(4)29)27(6)24(32)17(3)22(36-26(27)34)14-21(12-9-15)35-19(5)30/h7-9,11-13,17,20-23,31H,10,14H2,1-6H3,(H,28,33)/b11-8+,12-9+,15-7+,16-13+/t17-,20+,21-,22-,23-,27+/m1/s1.
What is the InChIKey of Sedecamycin?
The InChIKey of Sedecamycin is LSNBAGMWJRMBEO-VGBMZARNSA-N.
What is the Canonical SMILES of Sedecamycin?
The Canonical SMILES of Sedecamycin is CC1C2CC(C=CC(=CCC(C=CC(=CC(C(C1=O)(C(=O)O2)C)NC(=O)C(=O)C)C)O)C)OC(=O)C.
What is the molecular formula computed by Pubchem for Sedecamycin?
The molecular formula computed by PubChem for Sedecamycin is C27H35NO8.
What is the CAS number of Sedecamycin?
The CAS number of Sedecamycin is 102648-23-7.
What is the ChEMBL ID for Sedecamycin?
The ChEMBL ID for Sedecamycin is CHEMBL2105460.