What is the molecular formula of SB 277011 hydrochloride?
The molecular formula of SB 277011 hydrochloride is C28H31ClN4O.
What is the molecular weight of SB 277011 hydrochloride?
The molecular weight of SB 277011 hydrochloride is 475.0 g/mol.
What is the IUPAC name of SB 277011 hydrochloride?
The IUPAC name of SB 277011 hydrochloride is N-[4-[2-(6-cyano-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]cyclohexyl]quinoline-4-carboxamide;hydrochloride.
What is the InChIKey of SB 277011 hydrochloride?
The InChIKey of SB 277011 hydrochloride is DKPTUMKZXQOJCX-UHFFFAOYSA-N.
What is the Canonical SMILES of SB 277011 hydrochloride?
The Canonical SMILES of SB 277011 hydrochloride is C1CC(CCC1CCN2CCC3=C(C2)C=CC(=C3)C#N)NC(=O)C4=CC=NC5=CC=CC=C45.Cl.
What is the Hydrogen Bond Donor Count of SB 277011 hydrochloride?
The Hydrogen Bond Donor Count of SB 277011 hydrochloride is 2.
What is the Hydrogen Bond Acceptor Count of SB 277011 hydrochloride?
The Hydrogen Bond Acceptor Count of SB 277011 hydrochloride is 4.
What is the Rotatable Bond Count of SB 277011 hydrochloride?
The Rotatable Bond Count of SB 277011 hydrochloride is 5.
What is the Topological Polar Surface Area of SB 277011 hydrochloride?
The Topological Polar Surface Area of SB 277011 hydrochloride is 69Ų.
Is SB 277011 hydrochloride a canonicalized compound?
Yes, SB 277011 hydrochloride is a canonicalized compound.