What is the molecular formula of (S)-N-Fmoc-2-Bromophenylalanine?
The molecular formula of (S)-N-Fmoc-2-Bromophenylalanine is C24H20BrNO4.
What is the molecular weight of (S)-N-Fmoc-2-Bromophenylalanine?
The molecular weight of (S)-N-Fmoc-2-Bromophenylalanine is 466.3 g/mol.
What is the IUPAC name of (S)-N-Fmoc-2-Bromophenylalanine?
The IUPAC name of (S)-N-Fmoc-2-Bromophenylalanine is (2S)-3-(2-bromophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid.
What is the InChI of (S)-N-Fmoc-2-Bromophenylalanine?
The InChI of (S)-N-Fmoc-2-Bromophenylalanine is InChI=1S/C24H20BrNO4/c25-21-12-6-1-7-15(21)13-22(23(27)28)26-24(29)30-14-20-18-10-4-2-8-16(18)17-9-3-5-11-19(17)20/h1-12,20,22H,13-14H2,(H,26,29)(H,27,28)/t22-/m0/s1.
What is the InChIKey of (S)-N-Fmoc-2-Bromophenylalanine?
The InChIKey of (S)-N-Fmoc-2-Bromophenylalanine is GRJPAUULVKPBHU-QFIPXVFZSA-N.
What are the synonyms of (S)-N-Fmoc-2-Bromophenylalanine?
The synonyms of (S)-N-Fmoc-2-Bromophenylalanine are 220497-47-2, Fmoc-L-2-Bromophenylalanine, FMOC-PHE(2-BR)-OH, and Fmoc-2-bromo-L-phenylalanine.
What is the CAS number of (S)-N-Fmoc-2-Bromophenylalanine?
The CAS number of (S)-N-Fmoc-2-Bromophenylalanine is 220497-47-2.
What is the XLogP3-AA value of (S)-N-Fmoc-2-Bromophenylalanine?
The XLogP3-AA value of (S)-N-Fmoc-2-Bromophenylalanine is 5.3.
How many hydrogen bond donor counts are there in (S)-N-Fmoc-2-Bromophenylalanine?
There are 2 hydrogen bond donor counts in (S)-N-Fmoc-2-Bromophenylalanine.
How many rotatable bond counts are there in (S)-N-Fmoc-2-Bromophenylalanine?
There are 7 rotatable bond counts in (S)-N-Fmoc-2-Bromophenylalanine.
※ Please kindly note that our products are for research use only.