What is the molecular formula of (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid?
The molecular formula is C9H10O4.
What are some synonyms for (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid?
Some synonyms include (S)-2-hydroxy-3-(4-hydroxyphenyl)propanoic acid, (2S)-2-Hydroxy-3-(4-hydroxyphenyl)propanoic acid, and (s)-3-(4-hydroxyphenyl)lactic acid.
What is the molecular weight of (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid?
The molecular weight is 182.17 g/mol.
What is the IUPAC name of (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid?
The IUPAC name is (2S)-2-hydroxy-3-(4-hydroxyphenyl)propanoic acid.
What is the InChI of (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid?
The InChI is InChI=1S/C9H10O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8,10-11H,5H2,(H,12,13)/t8-/m0/s1.
What is the InChIKey of (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid?
The InChIKey is JVGVDSSUAVXRDY-QMMMGPOBSA-N.
What is the canonical SMILES of (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid?
The canonical SMILES is C1=CC(=CC=C1CC(C(=O)O)O)O.
What is the CAS number of (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid?
The CAS number is 23508-35-2.
How many hydrogen bond donor and acceptor counts does (S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid have?
(S)-3-(4-Hydroxyphenyl)-2-hydroxypropionic acid has 3 hydrogen bond donor counts and 4 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.