What is the PubChem CID for rotigotine?
The PubChem CID for rotigotine is 59227.
What is the molecular formula of rotigotine?
The molecular formula of rotigotine is C19H25NOS.
What is the molecular weight of rotigotine?
The molecular weight of rotigotine is 315.5 g/mol.
What is the IUPAC name of rotigotine?
The IUPAC name of rotigotine is (6S)-6-[propyl(2-thiophen-2-ylethyl)amino]-5,6,7,8-tetrahydronaphthalen-1-ol.
What is the InChI of rotigotine?
The InChI of rotigotine is InChI=1S/C19H25NOS/c1-2-11-20(12-10-17-6-4-13-22-17)16-8-9-18-15(14-16)5-3-7-19(18)21/h3-7,13,16,21H,2,8-12,14H2,1H3/t16-/m0/s1.
What is the InChIKey of rotigotine?
The InChIKey of rotigotine is KFQYTPMOWPVWEJ-INIZCTEOSA-N.
What is the canonical SMILES of rotigotine?
The canonical SMILES of rotigotine is CCCN(CCC1=CC=CS1)C2CCC3=C(C2)C=CC=C3O.
What is the CAS number of rotigotine?
The CAS number of rotigotine is 99755-59-6.
What is the UNII of rotigotine?
The UNII of rotigotine is 87T4T8BO2E.
What is the ChEMBL ID of rotigotine?
The ChEMBL ID of rotigotine is CHEMBL1303.