What is the PubChem CID of rimexolone?
The PubChem CID of rimexolone is 5311412.
What is the molecular formula of rimexolone?
The molecular formula of rimexolone is C24H34O3.
What is the molecular weight of rimexolone?
The molecular weight of rimexolone is 370.5 g/mol.
What is the IUPAC name of rimexolone?
The IUPAC name of rimexolone is (8S,9S,10R,11S,13S,14S,16R,17S)-11-hydroxy-10,13,16,17-tetramethyl-17-propanoyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-one.
What is the InChI of rimexolone?
The InChI of rimexolone is InChI=1S/C24H34O3/c1-6-20(27)24(5)14(2)11-18-17-8-7-15-12-16(25)9-10-22(15,3)21(17)19(26)13-23(18,24)4/h9-10,12,14,17-19,21,26H,6-8,11,13H2,1-5H3/t14-,17+,18+,19+,21-,22+,23+,24-/m1/s1.
What is the InChIKey of rimexolone?
The InChIKey of rimexolone is QTTRZHGPGKRAFB-OOKHYKNYSA-N.
What is the canonical SMILES of rimexolone?
The canonical SMILES of rimexolone is CCC(=O)C1(C(CC2C1(CC(C3C2CCC4=CC(=O)C=CC34C)O)C)C)C.
What is the CAS number of rimexolone?
The CAS number of rimexolone is 49697-38-3.
What is the XLogP3 value of rimexolone?
The XLogP3 value of rimexolone is 3.5.
What is the topological polar surface area of rimexolone?
The topological polar surface area of rimexolone is 54.4Ų.