What is the molecular formula of Rhodamine B hydrazide?
The molecular formula of Rhodamine B hydrazide is C28H32N4O2.
When was Rhodamine B hydrazide created and last modified?
Rhodamine B hydrazide was created on 2005-09-13 and last modified on 2023-12-30.
What is the InChIKey of Rhodamine B hydrazide?
The InChIKey of Rhodamine B hydrazide is WTDHTIVYKKLOTC-UHFFFAOYSA-N.
What is the molecular weight of Rhodamine B hydrazide?
The molecular weight of Rhodamine B hydrazide is 456.6 g/mol.
What is the Canonical SMILES of Rhodamine B hydrazide?
The Canonical SMILES of Rhodamine B hydrazide is CCN(CC)C1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)N(CC)CC)C5=CC=CC=C5C(=O)N3N.
What is the European Community (EC) Number for Rhodamine B hydrazide?
The European Community (EC) Number for Rhodamine B hydrazide is 634-768-9.
How many hydrogen bond acceptor counts does Rhodamine B hydrazide have?
Rhodamine B hydrazide has 5 hydrogen bond acceptor counts.
What is the XLogP3-AA value of Rhodamine B hydrazide?
The XLogP3-AA value of Rhodamine B hydrazide is 4.7.
What is the topological polar surface area of Rhodamine B hydrazide?
The topological polar surface area of Rhodamine B hydrazide is 62?2.
Is Rhodamine B hydrazide a canonicalized compound?
Yes, Rhodamine B hydrazide is a canonicalized compound.