What is the molecular formula of Rhodamine 116 perchlorate?
The molecular formula of Rhodamine 116 perchlorate is C22H19ClN2O7.
What is the molecular weight of Rhodamine 116 perchlorate?
The molecular weight of Rhodamine 116 perchlorate is 458.8 g/mol.
What is the IUPAC name of Rhodamine 116 perchlorate?
The IUPAC name of Rhodamine 116 perchlorate is [9-(2-carboxyphenyl)-6-(methylamino)xanthen-3-ylidene]-methylazanium;perchlorate.
What is the InChI of Rhodamine 116 perchlorate?
The InChI of Rhodamine 116 perchlorate is InChI=1S/C22H18N2O3.ClHO4/c1-23-13-7-9-17-19(11-13)27-20-12-14(24-2)8-10-18(20)21(17)15-5-3-4-6-16(15)22(25)26;2-1(3,4)5/h3-12,23H,1-2H3,(H,25,26);(H,2,3,4,5).
What is the InChIKey of Rhodamine 116 perchlorate?
The InChIKey of Rhodamine 116 perchlorate is PGRMUEVKABEERE-UHFFFAOYSA-N.
What is the canonical SMILES of Rhodamine 116 perchlorate?
The canonical SMILES of Rhodamine 116 perchlorate is CNC1=CC2=C(C=C1)C(=C3C=CC(=[NH+]C)C=C3O2)C4=CC=CC=C4C(=O)O.[O-]Cl(=O)(=O)=O.
What is the CAS number of Rhodamine 116 perchlorate?
The CAS number of Rhodamine 116 perchlorate is 62669-77-6.
What is the hydrogen bond donor count of Rhodamine 116 perchlorate?
The hydrogen bond donor count of Rhodamine 116 perchlorate is 3.
What is the hydrogen bond acceptor count of Rhodamine 116 perchlorate?
The hydrogen bond acceptor count of Rhodamine 116 perchlorate is 8.
What is the rotatable bond count of Rhodamine 116 perchlorate?
The rotatable bond count of Rhodamine 116 perchlorate is 3.
※ Please kindly note that our products are for research use only.