What is the molecular formula of RAD140?
The molecular formula of RAD140 is C20H16ClN5O2.
When was RAD140 created and last modified?
RAD140 was created on September 21, 2009, and last modified on December 30, 2023.
What is the synonym for RAD140?
The synonym for RAD140 is Vosilasarm.
What is the potential tissue-selective activity of RAD140 according to DrugBank?
RAD140 acts as an agonist in select tissues like skeletal muscle and bone, and as an antagonist in the prostate and breasts.
What is the molecular weight of RAD140?
The molecular weight of RAD140 is 393.8 g/mol.
What is the IUPAC name of RAD140?
The IUPAC name of RAD140 is 2-chloro-4-[[(1R,2S)-1-[5-(4-cyanophenyl)-1,3,4-oxadiazol-2-yl]-2-hydroxypropyl]amino]-3-methylbenzonitrile.
What is the InChIKey of RAD140?
The InChIKey of RAD140 is XMBUPPIEVAFYHO-KPZWWZAWSA-N.
What is the Canonical SMILES of RAD140?
The Canonical SMILES of RAD140 is CC1=C(C=CC(=C1Cl)C#N)NC(C2=NN=C(O2)C3=CC=C(C=C3)C#N)C(C)O.
What is the CAS number of RAD140?
The CAS number of RAD140 is 1182367-47-0.
What are some of the identifiers associated with RAD140?
Some of the identifiers associated with RAD140 are UNII, ChEMBL ID, DSSTox Substance ID, and Wikidata.