The molecular formula of Almorexant is C29H31F3N2O3.
What is the molecular weight of Almorexant?
The molecular weight of Almorexant is 512.6 g/mol.
What are the synonyms of Almorexant?
The synonyms of Almorexant include Almorexant, ACT-078573, and 871224-64-5.
What is the IUPAC Name of Almorexant?
The IUPAC Name of Almorexant is (2R)-2-[(1S)-6,7-dimethoxy-1-[2-[4-(trifluoromethyl)phenyl]ethyl]-3,4-dihydro-1H-isoquinolin-2-yl]-N-methyl-2-phenylacetamide.
What is the InChIKey of Almorexant?
The InChIKey of Almorexant is DKMACHNQISHMDN-RPLLCQBOSA-N.
What is the canonical SMILES of Almorexant?
The canonical SMILES of Almorexant is CNC(=O)C(C1=CC=CC=C1)N2CCC3=CC(=C(C=C3C2CCC4=CC=C(C=C4)C(F)(F)F)OC)OC.
What is the CAS number of Almorexant?
The CAS number of Almorexant is 871224-64-5.
What is the XLogP3-AA value of Almorexant?
The XLogP3-AA value of Almorexant is 6.
How many hydrogen bond acceptors does Almorexant have?
Almorexant has 7 hydrogen bond acceptors.
What is the topological polar surface area of Almorexant?
The topological polar surface area of Almorexant is 50.8 Å2.
※ Please kindly note that our products are for research use only.