What is the molecular formula of (R)-2-Methylpentanol?
The molecular formula is C6H14O.
What is the molecular weight of (R)-2-Methylpentanol?
The molecular weight is 102.17 g/mol.
What is the IUPAC name of (R)-2-Methylpentanol?
The IUPAC name is (2R)-2-methylpentan-1-ol.
What is the InChI of (R)-2-Methylpentanol?
The InChI is InChI=1S/C6H14O/c1-3-4-6(2)5-7/h6-7H,3-5H2,1-2H3/t6-/m1/s1.
What is the InChIKey of (R)-2-Methylpentanol?
The InChIKey is PFNHSEQQEPMLNI-ZCFIWIBFSA-N.
What is the canonical SMILES of (R)-2-Methylpentanol?
The canonical SMILES is CCCC(C)CO.
What are the synonyms of (R)-2-Methylpentanol?
Some of the synonyms are (2R)-2-methylpentan-1-ol, (R)-2-METHYLPENTANOL, and 17092-41-0.
How many hydrogen bond donor counts does (R)-2-Methylpentanol have?
It has 1 hydrogen bond donor count.
How many rotatable bond counts does (R)-2-Methylpentanol have?
It has 3 rotatable bond counts.
Is (R)-2-Methylpentanol a canonicalized compound?
Yes, it is a canonicalized compound.