PyBrOP

• Catalog Number: ACM132705512
• Product Name: PyBrOP
• CAS: 132705-51-2
• Category: Bromine Series
• Molecular Weight: 466.18
• Molecular Formula: C₁₂H₂₄BrN₃P?F₆P

Custom Q&A

What is the PubChem CID of the compound?

The PubChem CID of the compound is 2733179.

What is the molecular formula of the compound?

The molecular formula of the compound is C12H24BrF6N3P2.

What is the molecular weight of the compound?

The molecular weight of the compound is 466.18 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is bromo(tripyrrolidin-1-yl)phosphanium;hexafluorophosphate.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C12H24BrN3P.F6P/c13-17(14-7-1-2-8-14,15-9-3-4-10-15)16-11-5-6-12-16;1-7(2,3,4,5)6/h1-12H2;/q+1;-1.

What is the InChIKey of the compound?

The InChIKey of the compound is CYKRMWNZYOIJCH-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1CCN(C1)[P+](N2CCCC2)(N3CCCC3)Br.F[P-](F)(F)(F)(F)F.

What is the CAS number of the compound?

The CAS number of the compound is 132705-51-2.

What is the European Community (EC) number of the compound?

The European Community (EC) number of the compound is 620-834-4.

Is the compound canonicalized?

Yes, the compound is canonicalized.