What is the PubChem CID of the compound?
The PubChem CID of the compound is 636283.
What is the molecular formula of the compound?
The molecular formula of the compound is C36H44N4Pt.
What are the synonyms of the compound?
The synonyms of the compound are PtOEP, 31248-39-2, Platinum octaethylporphyrin, MFCD00672301, 2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide, and platinum(2+).
What is the molecular weight of the compound?
The molecular weight of the compound is 727.8 g/mol.
What is the parent compound of the compound?
The parent compound of the compound is CID 102311, which is 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine.
What are the component compounds of the compound?
The component compounds of the compound are Platinum (CID 23939) and 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine (CID 102311).
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2,3,7,8,12,13,17,18-octaethylporphyrin-22,24-diide;platinum(2+).
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C36H44N4.Pt/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-20H,9-16H2,1-8H3;/q-2;+2.
What is the InChIKey of the compound?
The InChIKey of the compound is WAODGUVBNLMTSF-UHFFFAOYSA-N.
Is the compound canonicalized?
Yes, the compound is canonicalized.