What is the molecular formula of Hydroxypropanedial?
The molecular formula of Hydroxypropanedial is C3H4O3.
What is another name for Hydroxypropanedial?
Another name for Hydroxypropanedial is Glucosereductone.
What is the molecular weight of Hydroxypropanedial?
The molecular weight of Hydroxypropanedial is 88.06 g/mol.
What is the IUPAC name of Hydroxypropanedial?
The IUPAC name of Hydroxypropanedial is 2-hydroxypropanedial.
What is the InChI of Hydroxypropanedial?
The InChI of Hydroxypropanedial is InChI=1S/C3H4O3/c4-1-3(6)2-5/h1-3,6H.
What is the Canonical SMILES of Hydroxypropanedial?
The Canonical SMILES of Hydroxypropanedial is C(=O)C(C=O)O.
What is the CAS number of Hydroxypropanedial?
The CAS number of Hydroxypropanedial is 497-15-4.
What is the XLogP3-AA value of Hydroxypropanedial?
The XLogP3-AA value of Hydroxypropanedial is -1.2.
How many hydrogen bond donor counts does Hydroxypropanedial have?
Hydroxypropanedial has 1 hydrogen bond donor count.
Is the compound canonicalized?
Yes, the compound is canonicalized.