What is the molecular formula of (Z11)-Hexadecenoic acid?
The molecular formula of (Z11)-Hexadecenoic acid is C16H30O2.
What is the molecular weight of (Z11)-Hexadecenoic acid?
The molecular weight of (Z11)-Hexadecenoic acid is 254.41 g/mol.
What is the IUPAC name of (Z11)-Hexadecenoic acid?
The IUPAC name of (Z11)-Hexadecenoic acid is (Z)-hexadec-11-enoic acid.
What is the InChI of (Z11)-Hexadecenoic acid?
The InChI of (Z11)-Hexadecenoic acid is InChI=1S/C16H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h5-6H,2-4,7-15H2,1H3,(H,17,18)/b6-5-.
What is the InChIKey of (Z11)-Hexadecenoic acid?
The InChIKey of (Z11)-Hexadecenoic acid is JGMYDQCXGIMHLL-WAYWQWQTSA-N.
What is the canonical SMILES of (Z11)-Hexadecenoic acid?
The canonical SMILES of (Z11)-Hexadecenoic acid is CCCCC=CCCCCCCCCCC(=O)O.
What is the isomeric SMILES of (Z11)-Hexadecenoic acid?
The isomeric SMILES of (Z11)-Hexadecenoic acid is CCCC/C=C\CCCCCCCCCC(=O)O.
What is the CAS number of (Z11)-Hexadecenoic acid?
The CAS number of (Z11)-Hexadecenoic acid is 2416-20-8.
What is the XLogP3 value of (Z11)-Hexadecenoic acid?
The XLogP3 value of (Z11)-Hexadecenoic acid is 6.1.
How many rotatable bonds are present in (Z11)-Hexadecenoic acid?
There are 13 rotatable bonds present in (Z11)-Hexadecenoic acid.