What is the PubChem CID of Trioctylamine?
The PubChem CID of Trioctylamine is 14227.
What is the molecular formula of Trioctylamine?
The molecular formula of Trioctylamine is C24H51N.
What are some synonyms for Trioctylamine?
Some synonyms for Trioctylamine include TRI-N-OCTYLAMINE, Tricaprylamine, and Tricaprylylamine.
What is the molecular weight of Trioctylamine?
The molecular weight of Trioctylamine is 353.7 g/mol.
What is the IUPAC name of Trioctylamine?
The IUPAC name of Trioctylamine is N,N-dioctyloctan-1-amine.
What is the InChI of Trioctylamine?
The InChI of Trioctylamine is InChI=1S/C24H51N/c1-4-7-10-13-16-19-22-25(23-20-17-14-11-8-5-2)24-21-18-15-12-9-6-3/h4-24H2,1-3H3.
What is the InChIKey of Trioctylamine?
The InChIKey of Trioctylamine is XTAZYLNFDRKIHJ-UHFFFAOYSA-N.
What is the canonical SMILES of Trioctylamine?
The canonical SMILES of Trioctylamine is CCCCCCCCN(CCCCCCCC)CCCCCCCC.
What is the CAS number of Trioctylamine?
The CAS number of Trioctylamine is 1116-76-3.
What is the ChEMBL ID of Trioctylamine?
The ChEMBL ID of Trioctylamine is CHEMBL3222022.