What is the molecular formula of Rhamnetin?
The molecular formula of Rhamnetin is C16H12O7.
What is the molecular weight of Rhamnetin?
The molecular weight of Rhamnetin is 316.26 g/mol.
What is the IUPAC name of Rhamnetin?
The IUPAC name of Rhamnetin is 2-(3,4-dihydroxyphenyl)-3,5-dihydroxy-7-methoxychromen-4-one.
What is the CAS number of Rhamnetin?
The CAS number of Rhamnetin is 90-19-7.
What is the InChIKey of Rhamnetin?
The InChIKey of Rhamnetin is JGUZGNYPMHHYRK-UHFFFAOYSA-N.
What is the Canonical SMILES of Rhamnetin?
The Canonical SMILES of Rhamnetin is COC1=CC(=C2C(=C1)OC(=C(C2=O)O)C3=CC(=C(C=C3)O)O).
What is the XLogP3 value of Rhamnetin?
The XLogP3 value of Rhamnetin is 1.9.
How many hydrogen bond donor counts does Rhamnetin have?
Rhamnetin has 4 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Rhamnetin have?
Rhamnetin has 7 hydrogen bond acceptor counts.
What is the topological polar surface area of Rhamnetin?
The topological polar surface area of Rhamnetin is 116 ?2.