What is the molecular formula of (R)-Tol-BINAP?
The molecular formula of (R)-Tol-BINAP is C48H40P2.
When was (R)-Tol-BINAP first created and last modified?
(R)-Tol-BINAP was first created on September 13, 2005, and last modified on December 30, 2023.
What is the IUPAC name of (R)-Tol-BINAP?
The IUPAC name of (R)-Tol-BINAP is [1-[2-bis(4-methylphenyl)phosphanylnaphthalen-1-yl]naphthalen-2-yl]-bis(4-methylphenyl)phosphane.
What is the molecular weight of (R)-Tol-BINAP?
The molecular weight of (R)-Tol-BINAP is 678.8 g/mol.
What is the Canonical SMILES of (R)-Tol-BINAP?
The Canonical SMILES of (R)-Tol-BINAP is CC1=CC=C(C=C1)P(C2=CC=C(C=C2)C)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(C7=CC=C(C=C7)C)C8=CC=C(C=C8)C.
How many rotatable bond counts does (R)-Tol-BINAP have?
(R)-Tol-BINAP has 7 rotatable bond counts.
What is the XLogP3-AA value of (R)-Tol-BINAP?
The XLogP3-AA value of (R)-Tol-BINAP is 12.9.
Does (R)-Tol-BINAP have any hydrogen bond donor or acceptor counts?
(R)-Tol-BINAP has 0 hydrogen bond donor and acceptor counts.
What is the exact mass and monoisotopic mass of (R)-Tol-BINAP?
The exact mass and monoisotopic mass of (R)-Tol-BINAP is 678.26052527 g/mol.
How many heavy atoms does (R)-Tol-BINAP contain?
(R)-Tol-BINAP contains 50 heavy atoms.
When was (R)-Tol-BINAP first created?
(R)-Tol-BINAP was first created on September 13, 2005.
What is the InChIKey of (R)-Tol-BINAP?
The InChIKey of (R)-Tol-BINAP is IOPQYDKQISFMJI-UHFFFAOYSA-N.
How many atom in total does (R)-Tol-BINAP contain?
(R)-Tol-BINAP contains a total of 50 atoms.
How many rotatable bonds does (R)-Tol-BINAP have?
(R)-Tol-BINAP has 7 rotatable bonds.
What is the formal charge of (R)-Tol-BINAP?
The formal charge of (R)-Tol-BINAP is 0.
How many hydrogen bond donor counts does (R)-Tol-BINAP have?
(R)-Tol-BINAP has 0 hydrogen bond donor counts.