What is the CAS number for Quinuclidine?
The CAS number for Quinuclidine is 100-76-5.
What are some synonyms for Quinuclidine?
Some synonyms for Quinuclidine are 1-Azabicyclo[2.2.2]octane and IUPAC Name 1-azabicyclo[2.2.2]octane.
What is the molecular weight of Quinuclidine?
The molecular weight of Quinuclidine is 111.18.
What is the molecular formula of Quinuclidine?
The molecular formula of Quinuclidine is C7H13N.
What is the SMILES notation for Quinuclidine?
The SMILES notation for Quinuclidine is C1CN2CCC1CC2.
What is the InChI for Quinuclidine?
The InChI for Quinuclidine is InChI=1S/C7H13N/c1-4-8-5-2-7(1)3-6-8/h7H,1-6H2.
What is the melting point of Quinuclidine?
The melting point of Quinuclidine is 158.0°C.
What percentage of Quinuclidine is considered active?
95% of Quinuclidine is considered active.
What is the physical state of Quinuclidine?
The physical state of Quinuclidine is solid.
What are some typical applications of Quinuclidine?
Some typical applications of Quinuclidine include its use as an antistatic agent, dispersing agent, emulsifying agent, and corrosion inhibitor.