What is the molecular formula of 1-Pyrenylboronic acid?
The molecular formula of 1-Pyrenylboronic acid is C16H11BO2.
What is the molecular weight of 1-Pyrenylboronic acid?
The molecular weight of 1-Pyrenylboronic acid is 246.1 g/mol.
What is the IUPAC name of 1-Pyrenylboronic acid?
The IUPAC name of 1-Pyrenylboronic acid is pyren-1-ylboronic acid.
What is the InChI of 1-Pyrenylboronic acid?
The InChI of 1-Pyrenylboronic acid is InChI=1S/C16H11BO2/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9,18-19H.
What is the InChIKey of 1-Pyrenylboronic acid?
The InChIKey of 1-Pyrenylboronic acid is MWEKPLLMFXIZOC-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Pyrenylboronic acid?
The canonical SMILES of 1-Pyrenylboronic acid is B(C1=C2C=CC3=CC=CC4=C3C2=C(C=C1)C=C4)(O)O.
What is the CAS number of 1-Pyrenylboronic acid?
The CAS number of 1-Pyrenylboronic acid is 164461-18-1.
What is the European Community (EC) number of 1-Pyrenylboronic acid?
The European Community (EC) number of 1-Pyrenylboronic acid is 813-398-3.
What is the Nikkaji Number of 1-Pyrenylboronic acid?
The Nikkaji Number of 1-Pyrenylboronic acid is J820.184F.
Is 1-Pyrenylboronic acid a covalently-bonded unit?
Yes, 1-Pyrenylboronic acid is a covalently-bonded unit with a count of 1.