What is the molecular formula of Pyrazofurin?
The molecular formula of Pyrazofurin is C9H13N3O6.
What are the synonyms of Pyrazofurin?
The synonyms of Pyrazofurin include Pirazofurin, Pyrazomycin, and Pirazofurinum.
What is the chemical name of Pyrazofurin?
The chemical name of Pyrazofurin is 3-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-hydroxy-1H-pyrazole-5-carboxamide.
What is the role of Pyrazofurin?
Pyrazofurin has a role as an antineoplastic agent, an antimetabolite, an EC 4.1.1.23 (orotidine-5'-phosphate decarboxylase) inhibitor, and an antimicrobial agent.
Is Pyrazofurin a C-glycosyl compound?
Yes, Pyrazofurin is a C-glycosyl compound.
What is Pyrazofurin functionally related to?
Pyrazofurin is functionally related to a beta-D-ribose.
What is the IUPAC name of Pyrazofurin?
The IUPAC name of Pyrazofurin is 3-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-hydroxy-1H-pyrazole-5-carboxamide.
What is the InChIKey of Pyrazofurin?
The InChIKey of Pyrazofurin is XESARGFCSKSFID-FLLFQEBCSA-N.
What is the Canonical SMILES of Pyrazofurin?
The Canonical SMILES of Pyrazofurin is C(C1C(C(C(O1)C2=NNC(=C2O)C(=O)N)O)O)O.
What is the modify date of Pyrazofurin?
The modify date of Pyrazofurin is 2023-08-26.