What is the PubChem CID of Pseudobaptigenin?
PubChem CID 5281805.
What is the molecular formula of Pseudobaptigenin?
The molecular formula is C16H10O5.
What is the molecular weight of Pseudobaptigenin?
The molecular weight is 282.25 g/mol.
What is the IUPAC name of Pseudobaptigenin?
The IUPAC name is 3-(1,3-benzodioxol-5-yl)-7-hydroxychromen-4-one.
What is the InChI of Pseudobaptigenin?
The InChI is InChI=1S/C16H10O5/c17-10-2-3-11-14(6-10)19-7-12(16(11)18)9-1-4-13-15(5-9)21-8-20-13/h1-7,17H,8H2.
What is the InChIKey of Pseudobaptigenin?
The InChIKey is KNJNBKINYHZUGC-UHFFFAOYSA-N.
What is the canonical SMILES of Pseudobaptigenin?
The canonical SMILES is C1OC2=C(O1)C=C(C=C2)C3=COC4=C(C3=O)C=CC(=C4)O.
What is the CAS number of Pseudobaptigenin?
The CAS number is 90-29-9.
What is the ChEMBL ID of Pseudobaptigenin?
The ChEMBL ID is CHEMBL486176.