What is the molecular formula of Phenylaminomethyltrimethoxysilane?
The molecular formula of Phenylaminomethyltrimethoxysilane is C10H17NO3Si.
What are some synonyms for Phenylaminomethyltrimethoxysilane?
Some synonyms for Phenylaminomethyltrimethoxysilane include N-((Trimethoxysilyl)methyl)aniline, ANILINO-METHYL-TRIMETHOXYSILANE, N-(trimethoxysilylmethyl)aniline, and PHENYLAMINOMETHYLTRIMETHOXYSILANE.
What is the molecular weight of Phenylaminomethyltrimethoxysilane?
The molecular weight of Phenylaminomethyltrimethoxysilane is 227.33 g/mol.
What is the IUPAC name of Phenylaminomethyltrimethoxysilane?
The IUPAC name of Phenylaminomethyltrimethoxysilane is N-(trimethoxysilylmethyl)aniline.
What is the InChI of Phenylaminomethyltrimethoxysilane?
The InChI of Phenylaminomethyltrimethoxysilane is InChI=1S/C10H17NO3Si/c1-12-15(13-2,14-3)9-11-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3.
What is the InChIKey of Phenylaminomethyltrimethoxysilane?
The InChIKey of Phenylaminomethyltrimethoxysilane is VNBLTKHUCJLFSB-UHFFFAOYSA-N.
What is the canonical SMILES of Phenylaminomethyltrimethoxysilane?
The canonical SMILES of Phenylaminomethyltrimethoxysilane is CO[Si](CNC1=CC=CC=C1)(OC)OC.
What is the CAS number of Phenylaminomethyltrimethoxysilane?
The CAS number of Phenylaminomethyltrimethoxysilane is 77855-73-3.
What is the EC number of Phenylaminomethyltrimethoxysilane?
The EC number of Phenylaminomethyltrimethoxysilane is 616-531-1.
Is Phenylaminomethyltrimethoxysilane a compound with defined atom or bond stereocenters?
No, Phenylaminomethyltrimethoxysilane does not have any defined atom or bond stereocenters.
※ Please kindly note that our products are for research use only.