What is the PubChem CID of nonyl valerate?
The PubChem CID of nonyl valerate is 568602.
What is the molecular formula of nonyl valerate?
The molecular formula of nonyl valerate is C14H28O2.
What are the synonyms of nonyl valerate?
The synonyms of nonyl valerate are Nonyl pentanoate and 94248-13-2.
What is the molecular weight of nonyl valerate?
The molecular weight of nonyl valerate is 228.37 g/mol.
When was nonyl valerate created in PubChem?
Nonyl valerate was created in PubChem on March 27, 2005.
What is the IUPAC name of nonyl valerate?
The IUPAC name of nonyl valerate is nonyl pentanoate.
What is the InChI of nonyl valerate?
The InChI of nonyl valerate is InChI=1S/C14H28O2/c1-3-5-7-8-9-10-11-13-16-14(15)12-6-4-2/h3-13H2,1-2H3.
What is the InChIKey of nonyl valerate?
The InChIKey of nonyl valerate is QACHAKPYKAPHJQ-UHFFFAOYSA-N.
What is the canonical SMILES of nonyl valerate?
The canonical SMILES of nonyl valerate is CCCCCCCCCOC(=O)CCCC.
Is nonyl valerate a canonicalized compound in PubChem?
Yes, nonyl valerate is a canonicalized compound in PubChem.