What is the molecular formula of neodiosmin?
The molecular formula of neodiosmin is C28H32O15.
What are the synonyms for neodiosmin?
The synonyms for neodiosmin are diosmetin-7-O-neohesperidoside and 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-4-oxo-4H-1-benzopyran-7-yl 2-O-(6-deoxy-alpha-L-mannopyranosyl)-beta-D-glucopyranoside.
What is the molecular weight of neodiosmin?
The molecular weight of neodiosmin is 608.5 g/mol.
When was neodiosmin created and modified?
Neodiosmin was created on 2012-12-01 and modified on 2023-10-21.
Where is neodiosmin found?
Neodiosmin is found in Citrus maxima, a type of citrus fruit.
What is the IUPAC name of neodiosmin?
The IUPAC name of neodiosmin is 7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)chromen-4-one.
What is the InChI of neodiosmin?
The InChI of neodiosmin is InChI=1S/C28H32O15/c1-10-21(33)23(35)25(37)27(39-10)43-26-24(36)22(34)19(9-29)42-28(26)40-12-6-14(31)20-15(32)8-17(41-18(20)7-12)11-3-4-16(38-2)13(30)5-11/h3-8,10,19,21-31,33-37H,9H2,1-2H3/t10-,19+,21-,22+,23+,24-,25+,26+,27-,28+/m0/s1.
What is the InChIKey of neodiosmin?
The InChIKey of neodiosmin is VCCNKWWXYVWTLT-CYZBKYQRSA-N.
What is the canonical SMILES of neodiosmin?
The canonical SMILES of neodiosmin is CC1C(C(C(C(O1)OC2C(C(C(OC2OC3=CC(=C4C(=C3)OC(=CC4=O)C5=CC(=C(C=C5)OC)O)O)CO)O)O)O)O)O.
What is the CAS number of neodiosmin?
The CAS number of neodiosmin is 38665-01-9.