What is the PubChem CID of N,N-Diisopropylethylamine p-toluenesulfonate salt?
The PubChem CID of N,N-Diisopropylethylamine p-toluenesulfonate salt is 6454383.
What is the molecular formula of N,N-Diisopropylethylamine p-toluenesulfonate salt?
The molecular formula of N,N-Diisopropylethylamine p-toluenesulfonate salt is C15H27NO3S.
What are some synonyms of N,N-Diisopropylethylamine p-toluenesulfonate salt?
Some synonyms of N,N-Diisopropylethylamine p-toluenesulfonate salt are Ethyldiisopropylammonium p-toluenesulphonate, N,N-Diisopropylethylamine p-toluenesulfonate, and EINECS 263-523-5.
What is the molecular weight of N,N-Diisopropylethylamine p-toluenesulfonate salt?
The molecular weight of N,N-Diisopropylethylamine p-toluenesulfonate salt is 301.4 g/mol.
What is the IUPAC name of N,N-Diisopropylethylamine p-toluenesulfonate salt?
The IUPAC name of N,N-Diisopropylethylamine p-toluenesulfonate salt is N-ethyl-N-propan-2-ylpropan-2-amine;4-methylbenzenesulfonic acid.
What is the InChI of N,N-Diisopropylethylamine p-toluenesulfonate salt?
The InChI of N,N-Diisopropylethylamine p-toluenesulfonate salt is InChI=1S/C8H19N.C7H8O3S/c1-6-9(7(2)3)8(4)5;1-6-2-4-7(5-3-6)11(8,9)10/h7-8H,6H2,1-5H3;2-5H,1H3,(H,8,9,10).
What is the InChIKey of N,N-Diisopropylethylamine p-toluenesulfonate salt?
The InChIKey of N,N-Diisopropylethylamine p-toluenesulfonate salt is WALRQYFNEKCLGF-UHFFFAOYSA-N.
What is the canonical SMILES of N,N-Diisopropylethylamine p-toluenesulfonate salt?
The canonical SMILES of N,N-Diisopropylethylamine p-toluenesulfonate salt is CCN(C(C)C)C(C)C.CC1=CC=C(C=C1)S(=O)(=O)O.
What is the CAS number of N,N-Diisopropylethylamine p-toluenesulfonate salt?
The CAS number of N,N-Diisopropylethylamine p-toluenesulfonate salt is 62359-01-7.
What is the European Community (EC) number of N,N-Diisopropylethylamine p-toluenesulfonate salt?
The European Community (EC) number of N,N-Diisopropylethylamine p-toluenesulfonate salt is 263-523-5.
※ Please kindly note that our products are for research use only.