What is the molecular formula of N-Hydroxymaleimide?
The molecular formula of N-Hydroxymaleimide is C4H3NO3.
What is the molecular weight of N-Hydroxymaleimide?
The molecular weight of N-Hydroxymaleimide is 113.07 g/mol.
What is the IUPAC name of N-Hydroxymaleimide?
The IUPAC name of N-Hydroxymaleimide is 1-hydroxypyrrole-2,5-dione.
What is the InChI of N-Hydroxymaleimide?
The InChI of N-Hydroxymaleimide is InChI=1S/C4H3NO3/c6-3-1-2-4(7)5(3)8/h1-2,8H.
What is the InChIKey of N-Hydroxymaleimide?
The InChIKey of N-Hydroxymaleimide is BUXKULRFRATXSI-UHFFFAOYSA-N.
What is the canonical SMILES of N-Hydroxymaleimide?
The canonical SMILES of N-Hydroxymaleimide is C1=CC(=O)N(C1=O)O.
What is the CAS number of N-Hydroxymaleimide?
The CAS number of N-Hydroxymaleimide is 4814-74-8.
What is the European Community (EC) number of N-Hydroxymaleimide?
The European Community (EC) number of N-Hydroxymaleimide is 225-385-4.
What is the DSSTox Substance ID of N-Hydroxymaleimide?
The DSSTox Substance ID of N-Hydroxymaleimide is DTXSID50197434.
Is N-Hydroxymaleimide a canonicalized compound?
Yes, N-Hydroxymaleimide is a canonicalized compound.