What is the molecular formula of N-butylboronic acid?
The molecular formula of N-butylboronic acid is C4H11BO2.
What is the molecular weight of N-butylboronic acid?
The molecular weight of N-butylboronic acid is 101.94 g/mol.
What is the IUPAC name of N-butylboronic acid?
The IUPAC name of N-butylboronic acid is butylboronic acid.
What is the InChI of N-butylboronic acid?
The InChI of N-butylboronic acid is InChI=1S/C4H11BO2/c1-2-3-4-5(6)7/h6-7H,2-4H2,1H3.
What is the InChIKey of N-butylboronic acid?
The InChIKey of N-butylboronic acid is QPKFVRWIISEVCW-UHFFFAOYSA-N.
What is the canonical SMILES of N-butylboronic acid?
The canonical SMILES of N-butylboronic acid is B(CCCC)(O)O.
What is the CAS number of N-butylboronic acid?
The CAS number of N-butylboronic acid is 4426-47-5.
What is the European Community (EC) number of N-butylboronic acid?
The European Community (EC) number of N-butylboronic acid is 224-607-7.
What is the ChEMBL ID of N-butylboronic acid?
The ChEMBL ID of N-butylboronic acid is CHEMBL31962.
Is N-butylboronic acid a canonicalized compound?
Yes, N-butylboronic acid is a canonicalized compound.