What is the molecular formula of 2-Methyl-1-heptanol?
The molecular formula of 2-Methyl-1-heptanol is C8H18O.
When was 2-Methyl-1-heptanol created and last modified in PubChem?
2-Methyl-1-heptanol was created on 2005-03-26 and last modified on 2023-12-30 in PubChem.
What is the IUPAC Name of 2-Methyl-1-heptanol?
The IUPAC Name of 2-Methyl-1-heptanol is 2-methylheptan-1-ol.
What is the InChI of 2-Methyl-1-heptanol?
The InChI of 2-Methyl-1-heptanol is InChI=1S/C8H18O/c1-3-4-5-6-8(2)7-9/h8-9H,3-7H2,1-2H3.
What is the InChIKey of 2-Methyl-1-heptanol?
The InChIKey of 2-Methyl-1-heptanol is QZESEQBMSFFHRY-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 2-Methyl-1-heptanol have?
2-Methyl-1-heptanol has 1 hydrogen bond donor count.
What is the XLogP3-AA value of 2-Methyl-1-heptanol?
The XLogP3-AA value of 2-Methyl-1-heptanol is 2.9.
What is the topological polar surface area of 2-Methyl-1-heptanol?
The topological polar surface area of 2-Methyl-1-heptanol is 20.2 Ų.
How many rotatable bond counts does 2-Methyl-1-heptanol have?
2-Methyl-1-heptanol has 5 rotatable bond counts.
Is 2-Methyl-1-heptanol a canonicalized compound?
Yes, 2-Methyl-1-heptanol is a canonicalized compound according to PubChem.