What is the molecular formula of Methyl 4-bromocrotonate?
The molecular formula of Methyl 4-bromocrotonate is C5H7BrO2.
What is the molecular weight of Methyl 4-bromocrotonate?
The molecular weight of Methyl 4-bromocrotonate is 179.01 g/mol.
What is the IUPAC name of Methyl 4-bromocrotonate?
The IUPAC name of Methyl 4-bromocrotonate is methyl (E)-4-bromobut-2-enoate.
What is the InChI of Methyl 4-bromocrotonate?
The InChI of Methyl 4-bromocrotonate is InChI=1S/C5H7BrO2/c1-8-5(7)3-2-4-6/h2-3H,4H2,1H3/b3-2+.
What is the InChIKey of Methyl 4-bromocrotonate?
The InChIKey of Methyl 4-bromocrotonate is RWIKCBHOVNDESJ-NSCUHMNNSA-N.
What is the CAS number of Methyl 4-bromocrotonate?
The CAS number of Methyl 4-bromocrotonate is 1117-71-1.
What is the European Community (EC) number of Methyl 4-bromocrotonate?
The European Community (EC) number of Methyl 4-bromocrotonate is 214-251-0.
What is the XLogP3-AA value of Methyl 4-bromocrotonate?
The XLogP3-AA value of Methyl 4-bromocrotonate is 1.1.
How many hydrogen bond donor counts does Methyl 4-bromocrotonate have?
Methyl 4-bromocrotonate has 0 hydrogen bond donor counts.
How many rotatable bond counts does Methyl 4-bromocrotonate have?
Methyl 4-bromocrotonate has 3 rotatable bond counts.