What is the molecular formula of methyl 2-oxoacetate?
The molecular formula of methyl 2-oxoacetate is C3H4O3.
What are some synonyms for methyl 2-oxoacetate?
Some synonyms for methyl 2-oxoacetate are methyl glyoxylate and methyl oxoacetate.
What is the molecular weight of methyl 2-oxoacetate?
The molecular weight of methyl 2-oxoacetate is 88.06 g/mol.
What is the IUPAC name of methyl 2-oxoacetate?
The IUPAC name of methyl 2-oxoacetate is methyl 2-oxoacetate.
What is the InChI of methyl 2-oxoacetate?
The InChI of methyl 2-oxoacetate is InChI=1S/C3H4O3/c1-6-3(5)2-4/h2H,1H3.
What is the InChIKey of methyl 2-oxoacetate?
The InChIKey of methyl 2-oxoacetate is KFKXSMSQHIOMSO-UHFFFAOYSA-N.
What is the canonical SMILES of methyl 2-oxoacetate?
The canonical SMILES of methyl 2-oxoacetate is COC(=O)C=O.
What is the CAS number of methyl 2-oxoacetate?
The CAS number of methyl 2-oxoacetate is 922-68-9.
How many hydrogen bond acceptor counts does methyl 2-oxoacetate have?
Methyl 2-oxoacetate has 3 hydrogen bond acceptor counts.