What is the molecular formula of Levosimendan?
The molecular formula of Levosimendan is C14H12N6O.
What is the molecular weight of Levosimendan?
The molecular weight of Levosimendan is 280.28 g/mol.
How does Levosimendan increase calcium sensitivity to myocytes?
Levosimendan increases calcium sensitivity to myocytes by binding to troponin C in a calcium-dependent manner.
What is the role of Levosimendan as?
Levosimendan has a role as a vasodilator agent, an EC 3.1.4.17 inhibitor, a cardiotonic drug, and an anti-arrhythmia drug.
How does Levosimendan manage acutely decompensated congestive heart failure?
It is used to manage acutely decompensated congestive heart failure by increasing contractility without raising calcium levels and by relaxing vascular smooth muscle.
What is the InChIKey of Levosimendan?
The InChIKey of Levosimendan is WHXMKTBCFHIYNQ-SECBINFHSA-N.
What is the Canonical SMILES of Levosimendan?
The Canonical SMILES of Levosimendan is CC1CC(=O)NN=C1C2=CC=C(C=C2)NN=C(C#N)C#N.
What is the CAS number of Levosimendan?
The CAS number of Levosimendan is 141505-33-1.
What is the European Community (EC) Number of Levosimendan?
The European Community (EC) Number of Levosimendan is 663-528-6.
How many hydrogen bond acceptors count does Levosimendan have?
Levosimendan has 6 hydrogen bond acceptors count.