What is the PubChem CID of Isopropyl stearate?
The PubChem CID of Isopropyl stearate is 8162.
What is the molecular formula of Isopropyl stearate?
The molecular formula of Isopropyl stearate is C21H42O2.
What are the synonyms of Isopropyl stearate?
The synonyms of Isopropyl stearate are ISOPROPYL STEARATE, 112-10-7, Octadecanoic acid, 1-methylethyl ester, propan-2-yl octadecanoate, Wickenol 127, and more.
What is the molecular weight of Isopropyl stearate?
The molecular weight of Isopropyl stearate is 326.6 g/mol.
What is the IUPAC name of Isopropyl stearate?
The IUPAC name of Isopropyl stearate is propan-2-yl octadecanoate.
What is the InChI of Isopropyl stearate?
The InChI of Isopropyl stearate is InChI=1S/C21H42O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(22)23-20(2)3/h20H,4-19H2,1-3H3.
What is the InChIKey of Isopropyl stearate?
The InChIKey of Isopropyl stearate is ZPWFUIUNWDIYCJ-UHFFFAOYSA-N.
What is the canonical SMILES of Isopropyl stearate?
The canonical SMILES of Isopropyl stearate is CCCCCCCCCCCCCCCCC(=O)OC(C)C.
What is the CAS number of Isopropyl stearate?
The CAS number of Isopropyl stearate is 112-10-7.
What is the UNII of Isopropyl stearate?
The UNII of Isopropyl stearate is 43253ZW1MZ.