What is the molecular formula of Ipsdienol?
The molecular formula of Ipsdienol is C10H16O.
What is the molecular weight of Ipsdienol?
The molecular weight of Ipsdienol is 152.23 g/mol.
What is the IUPAC name of Ipsdienol?
The IUPAC name of Ipsdienol is (4S)-2-methyl-6-methylideneocta-2,7-dien-4-ol.
What is the InChI of Ipsdienol?
The InChI of Ipsdienol is InChI=1S/C10H16O/c1-5-9(4)7-10(11)6-8(2)3/h5-6,10-11H,1,4,7H2,2-3H3/t10-/m1/s1.
What is the InChIKey of Ipsdienol?
The InChIKey of Ipsdienol is NHMKYUHMPXBMFI-SNVBAGLBSA-N.
What is the canonical SMILES of Ipsdienol?
The canonical SMILES of Ipsdienol is CC(=CC(CC(=C)C=C)O)C.
What is the CAS number of Ipsdienol?
The CAS number of Ipsdienol is 35628-00-3.
What is the XLogP3-AA value of Ipsdienol?
The XLogP3-AA value of Ipsdienol is 3.2.
How many hydrogen bond donor counts does Ipsdienol have?
Ipsdienol has 1 hydrogen bond donor count.
How many rotatable bond counts does Ipsdienol have?
Ipsdienol has 4 rotatable bond counts.